C15H14BrN3O — CID 131720229
5,12-dimethyl-2,8-diaza-5-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one bromide (PubChem CID 131720229) has the molecular formula C15H14BrN3O and a molecular weight of 332.20 g/mol. Its IUPAC name is 5,12-dimethyl-2,8-diaza-5-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one bromide.
| Compound Name | 5,12-dimethyl-2,8-diaza-5-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one bromide |
|---|---|
| PubChem CID | 131720229 |
| Molecular Formula | C15H14BrN3O |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5,12-dimethyl-2,8-diaza-5-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one bromide |
| SMILES | Cc1ccc2c(c1)-c1[nH]c(=O)c3n(cc[n+]3C)c1C2.[Br-] |
| InChI | InChI=1S/C15H13N3O.BrH/c1-9-3-4-10-8-12-13(11(10)7-9)16-14(19)15-17(2)5-6-18(12)15;/h3-7H,8H2,1-2H3;1H |
| InChIKey | RZUKTQOPFXFFMF-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|