C27H41N3O6S — CID 131720513
methyl 4-[(5S,6S,8R)-9-(butylamino)-5-formamido-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,3-dihydro-1,4-benzothiazine-2-carboxylate (PubChem CID 131720513) has the molecular formula C27H41N3O6S and a molecular weight of 535.71 g/mol. Its IUPAC name is methyl 4-[(5S,6S,8R)-9-(butylamino)-5-formamido-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,3-dihydro-1,4-benzothiazine-2-carboxylate.
| Compound Name | methyl 4-[(5S,6S,8R)-9-(butylamino)-5-formamido-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,3-dihydro-1,4-benzothiazine-2-carboxylate |
|---|---|
| PubChem CID | 131720513 |
| Molecular Formula | C27H41N3O6S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | methyl 4-[(5S,6S,8R)-9-(butylamino)-5-formamido-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-2,3-dihydro-1,4-benzothiazine-2-carboxylate |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC(C)(C)CC(=O)N1CC(C(=O)OC)Sc2ccccc21)NC=O |
| InChI | InChI=1S/C27H41N3O6S/c1-6-7-12-28-25(34)18(2)13-21(32)19(29-17-31)14-27(3,4)15-24(33)30-16-23(26(35)36-5)37-22-11-9-8-10-20(22)30/h8-11,17-19,21,23,32H,6-7,12-16H2,1-5H3,(H,28,34)(H,29,31)/t18-,19+,21+,23?/m1/s1 |
| InChIKey | SKDJAMUHRHFCSQ-OXMJVSSVSA-N |
| XLogP | 2.89 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|