About 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea
1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea (PubChem CID 13172179) has the molecular formula C11H24N2O3
and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea |
| PubChem CID | 13172179 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea |
| SMILES | COC(NC(=O)NC(C)(C)C)C(C)(C)OC |
| InChI | InChI=1S/C11H24N2O3/c1-10(2,3)13-9(14)12-8(15-6)11(4,5)16-7/h8H,1-7H3,(H2,12,13,14) |
| InChIKey | YREQWXDMDSAYDK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea?
The IUPAC name of 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea (CID 13172179) is 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea.
What is the SMILES notation for 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea?
The canonical SMILES for 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea is COC(NC(=O)NC(C)(C)C)C(C)(C)OC.
What is the InChIKey of 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea?
The InChIKey is YREQWXDMDSAYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O3/c1-10(2,3)13-9(14)12-8(15-6)11(4,5)16-7/h8H,1-7H3,(H2,12,13,14).
What are the key properties of 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea?
1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea has a molecular weight of 232.32 g/mol, XLogP of 1.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(1,2-dimethoxy-2-methylpropyl)urea is sourced from PubChem (CID 13172179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).