C7H2F12 — CID 131722199
1,1,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-1-ene (PubChem CID 131722199) has the molecular formula C7H2F12 and a molecular weight of 314.07 g/mol. Its IUPAC name is 1,1,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-1-ene.
| Compound Name | 1,1,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-1-ene |
|---|---|
| PubChem CID | 131722199 |
| Molecular Formula | C7H2F12 |
| Molecular Weight | 314.07 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 1,1,4,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)pent-1-ene |
| SMILES | FC(F)=C(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12/c8-3(9)2(5(11,12)13)1-4(10,6(14,15)16)7(17,18)19/h1H2 |
| InChIKey | YXRTZFLKZSAHPP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |