C30H28N2O5 — CID 131722231
ethyl 5-[[2,4-dioxo-5-(6,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)pyrimidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 131722231) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is ethyl 5-[[2,4-dioxo-5-(6,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)pyrimidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | ethyl 5-[[2,4-dioxo-5-(6,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)pyrimidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 131722231 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | ethyl 5-[[2,4-dioxo-5-(6,7,13-trimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenyl)pyrimidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(Cn2cc(C3c4ccc(C)cc4C=Cc4c3ccc(C)c4C)c(=O)[nH]c2=O)o1 |
| InChI | InChI=1S/C30H28N2O5/c1-5-36-29(34)26-13-9-21(37-26)15-32-16-25(28(33)31-30(32)35)27-23-10-6-17(2)14-20(23)8-12-22-19(4)18(3)7-11-24(22)27/h6-14,16,27H,5,15H2,1-4H3,(H,31,33,35) |
| InChIKey | JDAQXBPVFDBKRP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|