C24H30N4O — CID 131722251
3-[1-[(2S,4R)-2-benzylpiperidin-4-yl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 131722251) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[1-[(2S,4R)-2-benzylpiperidin-4-yl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[(2S,4R)-2-benzylpiperidin-4-yl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 131722251 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[1-[(2S,4R)-2-benzylpiperidin-4-yl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN([C@@H]2CCN[C@@H](Cc3ccccc3)C2)CC1 |
| InChI | InChI=1S/C24H30N4O/c29-24-26-22-8-4-5-9-23(22)28(24)20-11-14-27(15-12-20)21-10-13-25-19(17-21)16-18-6-2-1-3-7-18/h1-9,19-21,25H,10-17H2,(H,26,29)/t19-,21+/m0/s1 |
| InChIKey | SYWVITLPMKPZPT-PZJWPPBQSA-N |
| XLogP | 3.33 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |