C16H22BrNO4 — CID 131722439
methyl 2-[[3-(bromomethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate (PubChem CID 131722439) has the molecular formula C16H22BrNO4 and a molecular weight of 372.26 g/mol. Its IUPAC name is methyl 2-[[3-(bromomethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate.
| Compound Name | methyl 2-[[3-(bromomethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
|---|---|
| PubChem CID | 131722439 |
| Molecular Formula | C16H22BrNO4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | methyl 2-[[3-(bromomethyl)phenyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1cccc(CBr)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22BrNO4/c1-16(2,3)22-15(20)18(11-14(19)21-4)10-13-7-5-6-12(8-13)9-17/h5-8H,9-11H2,1-4H3 |
| InChIKey | FOSRPLDZCNLNNF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|