C46H59N2O3P — CID 131722811
1-[[(3S,4S)-1-[2-[bis(phenylmethoxy)phosphorylmethyl]cyclohexyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidine (PubChem CID 131722811) has the molecular formula C46H59N2O3P and a molecular weight of 718.96 g/mol. Its IUPAC name is 1-[[(3S,4S)-1-[2-[bis(phenylmethoxy)phosphorylmethyl]cyclohexyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidine.
| Compound Name | 1-[[(3S,4S)-1-[2-[bis(phenylmethoxy)phosphorylmethyl]cyclohexyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidine |
|---|---|
| PubChem CID | 131722811 |
| Molecular Formula | C46H59N2O3P |
| Molecular Weight | 718.96 g/mol |
| Exact Mass | 718.43 |
| IUPAC Name | 1-[[(3S,4S)-1-[2-[bis(phenylmethoxy)phosphorylmethyl]cyclohexyl]-4-phenylpyrrolidin-3-yl]methyl]-4-(3-phenylpropyl)piperidine |
| SMILES | O=P(CC1CCCCC1N1C[C@H](CN2CCC(CCCc3ccccc3)CC2)[C@@H](c2ccccc2)C1)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C46H59N2O3P/c49-52(50-35-40-18-7-2-8-19-40,51-36-41-20-9-3-10-21-41)37-43-26-13-14-27-46(43)48-33-44(45(34-48)42-24-11-4-12-25-42)32-47-30-28-39(29-31-47)23-15-22-38-16-5-1-6-17-38/h1-12,16-21,24-25,39,43-46H,13-15,22-23,26-37H2/t43?,44-,45+,46?/m0/s1 |
| InChIKey | IEMYVHZPMLTDKI-BKUGHHOCSA-N |
| XLogP | 10.62 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.96 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|