C22H29BrClNO — CID 131723349
1-benzyl-2-[(4-bromophenyl)-(dimethylamino)methyl]cyclohexan-1-ol;hydrochloride (PubChem CID 131723349) has the molecular formula C22H29BrClNO and a molecular weight of 438.84 g/mol. Its IUPAC name is 1-benzyl-2-[(4-bromophenyl)-(dimethylamino)methyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-benzyl-2-[(4-bromophenyl)-(dimethylamino)methyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 131723349 |
| Molecular Formula | C22H29BrClNO |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 1-benzyl-2-[(4-bromophenyl)-(dimethylamino)methyl]cyclohexan-1-ol;hydrochloride |
| SMILES | CN(C)C(c1ccc(Br)cc1)C1CCCCC1(O)Cc1ccccc1.Cl |
| InChI | InChI=1S/C22H28BrNO.ClH/c1-24(2)21(18-11-13-19(23)14-12-18)20-10-6-7-15-22(20,25)16-17-8-4-3-5-9-17;/h3-5,8-9,11-14,20-21,25H,6-7,10,15-16H2,1-2H3;1H |
| InChIKey | HBNYIXWVUYSXTF-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |