C23H25N2O4- — CID 131723411
(2S)-2-[(4S)-3-benzyl-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-methylpentanoate (PubChem CID 131723411) has the molecular formula C23H25N2O4- and a molecular weight of 393.46 g/mol. Its IUPAC name is (2S)-2-[(4S)-3-benzyl-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-methylpentanoate.
| Compound Name | (2S)-2-[(4S)-3-benzyl-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 131723411 |
| Molecular Formula | C23H25N2O4- |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (2S)-2-[(4S)-3-benzyl-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](C(=O)[O-])N1C(=O)N(Cc2ccccc2)[C@@](C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C23H26N2O4/c1-16(2)14-19(20(26)27)25-21(28)23(3,18-12-8-5-9-13-18)24(22(25)29)15-17-10-6-4-7-11-17/h4-13,16,19H,14-15H2,1-3H3,(H,26,27)/p-1/t19-,23-/m0/s1 |
| InChIKey | XEDVKEAGEHUTQQ-CVDCTZTESA-M |
| XLogP | 2.53 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|