About 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt
2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt (PubChem CID 131723811) has the molecular formula C18H28Li2OSi
and a molecular weight of 302.39 g/mol.
Molecular Properties
| Compound Name | 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt |
| PubChem CID | 131723811 |
| Molecular Formula | C18H28Li2OSi |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | — |
| SMILES | CC(CCCO[Si](C)(C)C)(C1C=CC=C1)C1C=CC=C1.[Li].[Li] |
| InChI | InChI=1S/C18H28OSi.2Li/c1-18(16-10-5-6-11-16,17-12-7-8-13-17)14-9-15-19-20(2,3)4;;/h5-8,10-13,16-17H,9,14-15H2,1-4H3;; |
| InChIKey | UEEZZWWWSUNPHS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt?
The IUPAC name of 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt (CID 131723811) is not available.
What is the SMILES notation for 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt?
The canonical SMILES for 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt is CC(CCCO[Si](C)(C)C)(C1C=CC=C1)C1C=CC=C1.[Li].[Li].
What is the InChIKey of 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt?
The InChIKey is UEEZZWWWSUNPHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28OSi.2Li/c1-18(16-10-5-6-11-16,17-12-7-8-13-17)14-9-15-19-20(2,3)4;;/h5-8,10-13,16-17H,9,14-15H2,1-4H3;;.
What are the key properties of 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt?
2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt has a molecular weight of 302.39 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-Bis(cyclopentadienyl)-5trimethylsiloxypentane dilithium salt is sourced from PubChem (CID 131723811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).