About (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one
(5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one (PubChem CID 131724428) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one |
| PubChem CID | 131724428 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one |
| SMILES | C[C@@H]1CCC(C(C)(C)c2ccc3ccc4cccnc4c3n2)C(=O)C1 |
| InChI | InChI=1S/C22H24N2O/c1-14-6-10-17(18(25)13-14)22(2,3)19-11-9-16-8-7-15-5-4-12-23-20(15)21(16)24-19/h4-5,7-9,11-12,14,17H,6,10,13H2,1-3H3/t14-,17?/m1/s1 |
| InChIKey | RNANSFGEFAXZCE-XPCCGILXSA-N |
| XLogP | 5.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one?
The IUPAC name of (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one (CID 131724428) is (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one.
What is the SMILES notation for (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one?
The canonical SMILES for (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one is C[C@@H]1CCC(C(C)(C)c2ccc3ccc4cccnc4c3n2)C(=O)C1.
What is the InChIKey of (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one?
The InChIKey is RNANSFGEFAXZCE-XPCCGILXSA-N. The full InChI is InChI=1S/C22H24N2O/c1-14-6-10-17(18(25)13-14)22(2,3)19-11-9-16-8-7-15-5-4-12-23-20(15)21(16)24-19/h4-5,7-9,11-12,14,17H,6,10,13H2,1-3H3/t14-,17?/m1/s1.
What are the key properties of (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one?
(5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one has a molecular weight of 332.45 g/mol, XLogP of 5.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one is sourced from PubChem (CID 131724428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).