C22H24N2O — CID 131724428
(5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one (PubChem CID 131724428) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one.
| Compound Name | (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 131724428 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (5R)-5-methyl-2-[2-(1,10-phenanthrolin-2-yl)propan-2-yl]cyclohexan-1-one |
| SMILES | C[C@@H]1CCC(C(C)(C)c2ccc3ccc4cccnc4c3n2)C(=O)C1 |
| InChI | InChI=1S/C22H24N2O/c1-14-6-10-17(18(25)13-14)22(2,3)19-11-9-16-8-7-15-5-4-12-23-20(15)21(16)24-19/h4-5,7-9,11-12,14,17H,6,10,13H2,1-3H3/t14-,17?/m1/s1 |
| InChIKey | RNANSFGEFAXZCE-XPCCGILXSA-N |
| XLogP | 5.07 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|