About bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+)
bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) (PubChem CID 131724440) has the molecular formula C26H24FeN2O2
and a molecular weight of 452.34 g/mol. Its IUPAC name is bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+).
Molecular Properties
| Compound Name | bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) |
| PubChem CID | 131724440 |
| Molecular Formula | C26H24FeN2O2 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) |
| SMILES | O=C(Cc1ccccc1)Nc1ccc[cH-]1.O=C(Cc1ccccc1)Nc1ccc[cH-]1.[Fe+2] |
| InChI | InChI=1S/2C13H12NO.Fe/c2*15-13(14-12-8-4-5-9-12)10-11-6-2-1-3-7-11;/h2*1-9H,10H2,(H,14,15);/q2*-1;+2 |
| InChIKey | IGAJWVHPRWKITH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+)?
The IUPAC name of bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) (CID 131724440) is bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+).
What is the SMILES notation for bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+)?
The canonical SMILES for bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) is O=C(Cc1ccccc1)Nc1ccc[cH-]1.O=C(Cc1ccccc1)Nc1ccc[cH-]1.[Fe+2].
What is the InChIKey of bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+)?
The InChIKey is IGAJWVHPRWKITH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H12NO.Fe/c2*15-13(14-12-8-4-5-9-12)10-11-6-2-1-3-7-11;/h2*1-9H,10H2,(H,14,15);/q2*-1;+2.
What are the key properties of bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+)?
bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) has a molecular weight of 452.34 g/mol, XLogP of 5.17, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-cyclopenta-1,3-dien-1-yl-2-phenylacetamide);iron(2+) is sourced from PubChem (CID 131724440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).