About dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane
dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane (PubChem CID 131724618) has the molecular formula C12H25Cl2F3O2Si
and a molecular weight of 357.32 g/mol. Its IUPAC name is dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane |
| PubChem CID | 131724618 |
| Molecular Formula | C12H25Cl2F3O2Si |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane |
| SMILES | CC(C)[SiH](C(C)C)C(C)C.ClCCl.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H22Si.C2HF3O2.CH2Cl2/c1-7(2)10(8(3)4)9(5)6;3-2(4,5)1(6)7;2-1-3/h7-10H,1-6H3;(H,6,7);1H2 |
| InChIKey | AUUONGSDLNKQGW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane?
The IUPAC name of dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane (CID 131724618) is dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane.
What is the SMILES notation for dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane?
The canonical SMILES for dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane is CC(C)[SiH](C(C)C)C(C)C.ClCCl.O=C(O)C(F)(F)F.
What is the InChIKey of dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane?
The InChIKey is AUUONGSDLNKQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22Si.C2HF3O2.CH2Cl2/c1-7(2)10(8(3)4)9(5)6;3-2(4,5)1(6)7;2-1-3/h7-10H,1-6H3;(H,6,7);1H2.
What are the key properties of dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane?
dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane has a molecular weight of 357.32 g/mol, XLogP of 5.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2,2,2-trifluoroacetic acid;tri(propan-2-yl)silane is sourced from PubChem (CID 131724618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).