C15H28F3NO5S — CID 131724753
5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid (PubChem CID 131724753) has the molecular formula C15H28F3NO5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 131724753 |
| Molecular Formula | C15H28F3NO5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid |
| SMILES | CNC1CCC(CCCCCOS(C)(=O)=O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H27NO3S.C2HF3O2/c1-14-13-9-7-12(8-10-13)6-4-3-5-11-17-18(2,15)16;3-2(4,5)1(6)7/h12-14H,3-11H2,1-2H3;(H,6,7) |
| InChIKey | GOAPVDQPBYHJMJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|