About 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid
5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid (PubChem CID 131724753) has the molecular formula C15H28F3NO5S
and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid |
| PubChem CID | 131724753 |
| Molecular Formula | C15H28F3NO5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid |
| SMILES | CNC1CCC(CCCCCOS(C)(=O)=O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H27NO3S.C2HF3O2/c1-14-13-9-7-12(8-10-13)6-4-3-5-11-17-18(2,15)16;3-2(4,5)1(6)7/h12-14H,3-11H2,1-2H3;(H,6,7) |
| InChIKey | GOAPVDQPBYHJMJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid?
The IUPAC name of 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid (CID 131724753) is 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid?
The canonical SMILES for 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid is CNC1CCC(CCCCCOS(C)(=O)=O)CC1.O=C(O)C(F)(F)F.
What is the InChIKey of 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid?
The InChIKey is GOAPVDQPBYHJMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO3S.C2HF3O2/c1-14-13-9-7-12(8-10-13)6-4-3-5-11-17-18(2,15)16;3-2(4,5)1(6)7/h12-14H,3-11H2,1-2H3;(H,6,7).
What are the key properties of 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid?
5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid has a molecular weight of 391.45 g/mol, XLogP of 2.93, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(methylamino)cyclohexyl]pentyl methanesulfonate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 131724753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).