About (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one
(5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one (PubChem CID 131724770) has the molecular formula C6H7BrO5
and a molecular weight of 239.02 g/mol. Its IUPAC name is (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one.
Molecular Properties
| Compound Name | (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one |
| PubChem CID | 131724770 |
| Molecular Formula | C6H7BrO5 |
| Molecular Weight | 239.02 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one |
| SMILES | C[C@H](O)[C@@]1(Br)OC(=O)C(O)=C1O |
| InChI | InChI=1S/C6H7BrO5/c1-2(8)6(7)4(10)3(9)5(11)12-6/h2,8-10H,1H3/t2-,6+/m0/s1 |
| InChIKey | YMOKUFVJGLVTQG-LBNWCAIBSA-N |
| XLogP | 0.34 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.02 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one?
The IUPAC name of (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one (CID 131724770) is (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one.
What is the SMILES notation for (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one?
The canonical SMILES for (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one is C[C@H](O)[C@@]1(Br)OC(=O)C(O)=C1O.
What is the InChIKey of (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one?
The InChIKey is YMOKUFVJGLVTQG-LBNWCAIBSA-N. The full InChI is InChI=1S/C6H7BrO5/c1-2(8)6(7)4(10)3(9)5(11)12-6/h2,8-10H,1H3/t2-,6+/m0/s1.
What are the key properties of (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one?
(5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one has a molecular weight of 239.02 g/mol, XLogP of 0.34, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-bromo-3,4-dihydroxy-5-[(1S)-1-hydroxyethyl]furan-2-one is sourced from PubChem (CID 131724770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).