C13F24O6 — CID 131724887
[1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]propyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 131724887) has the molecular formula C13F24O6 and a molecular weight of 708.09 g/mol. Its IUPAC name is [1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]propyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]propyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 131724887 |
| Molecular Formula | C13F24O6 |
| Molecular Weight | 708.09 g/mol |
| Exact Mass | 707.93 |
| IUPAC Name | [1,1,2,3,3,3-hexafluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(2,2,3,3,3-pentafluoropropanoyloxy)ethoxy]ethoxy]propyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)OC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13F24O6/c14-3(15,6(19,20)21)1(38)40-9(28,29)5(18,8(25,26)27)42-12(34,35)13(36,37)43-11(32,33)10(30,31)41-2(39)4(16,17)7(22,23)24 |
| InChIKey | KJICLYPNENAPFE-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.09 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|