C44H36N6O3 — CID 131724909
N-[3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]furan-2-carboxamide (PubChem CID 131724909) has the molecular formula C44H36N6O3 and a molecular weight of 696.81 g/mol. Its IUPAC name is N-[3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 131724909 |
| Molecular Formula | C44H36N6O3 |
| Molecular Weight | 696.81 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | N-[3-[1-(oxan-2-yl)-5-(1-trityl-1,2,4-triazol-3-yl)indazol-3-yl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nn(C3CCCCO3)c3ccc(-c4ncn(C(c5ccccc5)(c5ccccc5)c5ccccc5)n4)cc23)c1)c1ccco1 |
| InChI | InChI=1S/C44H36N6O3/c51-43(39-22-13-27-52-39)46-36-21-12-14-31(28-36)41-37-29-32(24-25-38(37)50(47-41)40-23-10-11-26-53-40)42-45-30-49(48-42)44(33-15-4-1-5-16-33,34-17-6-2-7-18-34)35-19-8-3-9-20-35/h1-9,12-22,24-25,27-30,40H,10-11,23,26H2,(H,46,51) |
| InChIKey | VGDUDIRDCWDQOP-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.81 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|