About 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride
2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride (PubChem CID 131725227) has the molecular formula C14H21ClN6O2
and a molecular weight of 340.82 g/mol. Its IUPAC name is 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride |
| PubChem CID | 131725227 |
| Molecular Formula | C14H21ClN6O2 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride |
| SMILES | C[C@@H]1CN(CC(=O)O)C[C@H](C)N1c1ncnc2c1ncn2C.Cl |
| InChI | InChI=1S/C14H20N6O2.ClH/c1-9-4-19(6-11(21)22)5-10(2)20(9)14-12-13(15-7-16-14)18(3)8-17-12;/h7-10H,4-6H2,1-3H3,(H,21,22);1H/t9-,10+; |
| InChIKey | QSJASUGZRQGEFJ-JMVWIVNTSA-N |
| XLogP | 0.77 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride?
The IUPAC name of 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride (CID 131725227) is 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride.
What is the SMILES notation for 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride?
The canonical SMILES for 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride is C[C@@H]1CN(CC(=O)O)C[C@H](C)N1c1ncnc2c1ncn2C.Cl.
What is the InChIKey of 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride?
The InChIKey is QSJASUGZRQGEFJ-JMVWIVNTSA-N. The full InChI is InChI=1S/C14H20N6O2.ClH/c1-9-4-19(6-11(21)22)5-10(2)20(9)14-12-13(15-7-16-14)18(3)8-17-12;/h7-10H,4-6H2,1-3H3,(H,21,22);1H/t9-,10+;.
What are the key properties of 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride?
2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride has a molecular weight of 340.82 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,5S)-3,5-dimethyl-4-(9-methylpurin-6-yl)piperazin-1-yl]acetic acid;hydrochloride is sourced from PubChem (CID 131725227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).