About methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate
methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate (PubChem CID 131725232) has the molecular formula C6H15NO5S
and a molecular weight of 213.25 g/mol. Its IUPAC name is methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate.
Molecular Properties
| Compound Name | methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate |
| PubChem CID | 131725232 |
| Molecular Formula | C6H15NO5S |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate |
| SMILES | CN1CCCC1=O.CS(=O)(=O)O.O |
| InChI | InChI=1S/C5H9NO.CH4O3S.H2O/c1-6-4-2-3-5(6)7;1-5(2,3)4;/h2-4H2,1H3;1H3,(H,2,3,4);1H2 |
| InChIKey | QBJVQARWXHLJSK-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate?
The IUPAC name of methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate (CID 131725232) is methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate.
What is the SMILES notation for methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate?
The canonical SMILES for methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate is CN1CCCC1=O.CS(=O)(=O)O.O.
What is the InChIKey of methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate?
The InChIKey is QBJVQARWXHLJSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.CH4O3S.H2O/c1-6-4-2-3-5(6)7;1-5(2,3)4;/h2-4H2,1H3;1H3,(H,2,3,4);1H2.
What are the key properties of methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate?
methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate has a molecular weight of 213.25 g/mol, XLogP of -1.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;1-methylpyrrolidin-2-one;hydrate is sourced from PubChem (CID 131725232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).