About methyl-penta-1,4-dien-3-yl-silyloxysilane
methyl-penta-1,4-dien-3-yl-silyloxysilane (PubChem CID 131725769) has the molecular formula C6H14OSi2
and a molecular weight of 158.35 g/mol. Its IUPAC name is methyl-penta-1,4-dien-3-yl-silyloxysilane.
Molecular Properties
| Compound Name | methyl-penta-1,4-dien-3-yl-silyloxysilane |
| PubChem CID | 131725769 |
| Molecular Formula | C6H14OSi2 |
| Molecular Weight | 158.35 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | methyl-penta-1,4-dien-3-yl-silyloxysilane |
| SMILES | C=CC(C=C)[SiH](C)O[SiH3] |
| InChI | InChI=1S/C6H14OSi2/c1-4-6(5-2)9(3)7-8/h4-6,9H,1-2H2,3,8H3 |
| InChIKey | PVDQRIYGXOBYLY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl-penta-1,4-dien-3-yl-silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-penta-1,4-dien-3-yl-silyloxysilane?
The IUPAC name of methyl-penta-1,4-dien-3-yl-silyloxysilane (CID 131725769) is methyl-penta-1,4-dien-3-yl-silyloxysilane.
What is the SMILES notation for methyl-penta-1,4-dien-3-yl-silyloxysilane?
The canonical SMILES for methyl-penta-1,4-dien-3-yl-silyloxysilane is C=CC(C=C)[SiH](C)O[SiH3].
What is the InChIKey of methyl-penta-1,4-dien-3-yl-silyloxysilane?
The InChIKey is PVDQRIYGXOBYLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14OSi2/c1-4-6(5-2)9(3)7-8/h4-6,9H,1-2H2,3,8H3.
What are the key properties of methyl-penta-1,4-dien-3-yl-silyloxysilane?
methyl-penta-1,4-dien-3-yl-silyloxysilane has a molecular weight of 158.35 g/mol, XLogP of 0.38, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-penta-1,4-dien-3-yl-silyloxysilane is sourced from PubChem (CID 131725769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).