About dimethyl-penta-1,4-dien-3-yl-silyloxysilane
dimethyl-penta-1,4-dien-3-yl-silyloxysilane (PubChem CID 131725770) has the molecular formula C7H16OSi2
and a molecular weight of 172.38 g/mol. Its IUPAC name is dimethyl-penta-1,4-dien-3-yl-silyloxysilane.
Molecular Properties
| Compound Name | dimethyl-penta-1,4-dien-3-yl-silyloxysilane |
| PubChem CID | 131725770 |
| Molecular Formula | C7H16OSi2 |
| Molecular Weight | 172.38 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | dimethyl-penta-1,4-dien-3-yl-silyloxysilane |
| SMILES | C=CC(C=C)[Si](C)(C)O[SiH3] |
| InChI | InChI=1S/C7H16OSi2/c1-5-7(6-2)10(3,4)8-9/h5-7H,1-2H2,3-4,9H3 |
| InChIKey | JFFKPQMSNCLMIE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-penta-1,4-dien-3-yl-silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-penta-1,4-dien-3-yl-silyloxysilane?
The IUPAC name of dimethyl-penta-1,4-dien-3-yl-silyloxysilane (CID 131725770) is dimethyl-penta-1,4-dien-3-yl-silyloxysilane.
What is the SMILES notation for dimethyl-penta-1,4-dien-3-yl-silyloxysilane?
The canonical SMILES for dimethyl-penta-1,4-dien-3-yl-silyloxysilane is C=CC(C=C)[Si](C)(C)O[SiH3].
What is the InChIKey of dimethyl-penta-1,4-dien-3-yl-silyloxysilane?
The InChIKey is JFFKPQMSNCLMIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OSi2/c1-5-7(6-2)10(3,4)8-9/h5-7H,1-2H2,3-4,9H3.
What are the key properties of dimethyl-penta-1,4-dien-3-yl-silyloxysilane?
dimethyl-penta-1,4-dien-3-yl-silyloxysilane has a molecular weight of 172.38 g/mol, XLogP of 1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-penta-1,4-dien-3-yl-silyloxysilane is sourced from PubChem (CID 131725770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).