About (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane
(E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane (PubChem CID 131725809) has the molecular formula C14H18ClN3O4
and a molecular weight of 327.77 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane |
| PubChem CID | 131725809 |
| Molecular Formula | C14H18ClN3O4 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane |
| SMILES | Clc1cncc(N2CCCNCC2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H14ClN3.C4H4O4/c11-9-6-10(8-13-7-9)14-4-1-2-12-3-5-14;5-3(6)1-2-4(7)8/h6-8,12H,1-5H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KOTJOMATMCXZOH-WLHGVMLRSA-N |
| XLogP | 1.25 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane?
The IUPAC name of (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane (CID 131725809) is (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane.
What is the SMILES notation for (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane?
The canonical SMILES for (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane is Clc1cncc(N2CCCNCC2)c1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane?
The InChIKey is KOTJOMATMCXZOH-WLHGVMLRSA-N. The full InChI is InChI=1S/C10H14ClN3.C4H4O4/c11-9-6-10(8-13-7-9)14-4-1-2-12-3-5-14;5-3(6)1-2-4(7)8/h6-8,12H,1-5H2;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane?
(E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane has a molecular weight of 327.77 g/mol, XLogP of 1.25, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;1-(5-chloro-3-pyridinyl)-1,4-diazepane is sourced from PubChem (CID 131725809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).