About sodium;boranuide;tetraoxoosmium
sodium;boranuide;tetraoxoosmium (PubChem CID 131725947) has the molecular formula H4BNaO4Os
and a molecular weight of 292.06 g/mol. Its IUPAC name is sodium;boranuide;tetraoxoosmium.
Molecular Properties
| Compound Name | sodium;boranuide;tetraoxoosmium |
| PubChem CID | 131725947 |
| Molecular Formula | H4BNaO4Os |
| Molecular Weight | 292.06 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | sodium;boranuide;tetraoxoosmium |
| SMILES | O=[Os](=O)(=O)=O.[BH4-].[Na+] |
| InChI | InChI=1S/BH4.Na.4O.Os/h1H4;;;;;;/q-1;+1;;;;; |
| InChIKey | CVNPFJBGVIIWIE-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.06 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;boranuide;tetraoxoosmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;boranuide;tetraoxoosmium?
The IUPAC name of sodium;boranuide;tetraoxoosmium (CID 131725947) is sodium;boranuide;tetraoxoosmium.
What is the SMILES notation for sodium;boranuide;tetraoxoosmium?
The canonical SMILES for sodium;boranuide;tetraoxoosmium is O=[Os](=O)(=O)=O.[BH4-].[Na+].
What is the InChIKey of sodium;boranuide;tetraoxoosmium?
The InChIKey is CVNPFJBGVIIWIE-UHFFFAOYSA-N. The full InChI is InChI=1S/BH4.Na.4O.Os/h1H4;;;;;;/q-1;+1;;;;;.
What are the key properties of sodium;boranuide;tetraoxoosmium?
sodium;boranuide;tetraoxoosmium has a molecular weight of 292.06 g/mol, XLogP of -4.93, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;boranuide;tetraoxoosmium is sourced from PubChem (CID 131725947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).