C31H34N2O8 — CID 131725987
(2S,3S)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2S,3S,6S)-6-ethyl-2-phenylpiperidin-3-amine (PubChem CID 131725987) has the molecular formula C31H34N2O8 and a molecular weight of 562.62 g/mol. Its IUPAC name is (2S,3S)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2S,3S,6S)-6-ethyl-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2S,3S,6S)-6-ethyl-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 131725987 |
| Molecular Formula | C31H34N2O8 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | (2S,3S)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(2S,3S,6S)-6-ethyl-2-phenylpiperidin-3-amine |
| SMILES | CC[C@H]1CC[C@H](N)[C@H](c2ccccc2)N1.O=C(O)[C@@](O)(C(=O)c1ccccc1)[C@@](O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C13H20N2/c19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12;1-2-11-8-9-12(14)13(15-11)10-6-4-3-5-7-10/h1-10,25-26H,(H,21,22)(H,23,24);3-7,11-13,15H,2,8-9,14H2,1H3/t17-,18-;11-,12-,13-/m00/s1 |
| InChIKey | CDFPABGCYVOKLE-ALNDACHFSA-N |
| XLogP | 2.60 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|