About 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride
2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride (PubChem CID 131726170) has the molecular formula C8H11Cl2N5O2
and a molecular weight of 280.12 g/mol. Its IUPAC name is 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride |
| PubChem CID | 131726170 |
| Molecular Formula | C8H11Cl2N5O2 |
| Molecular Weight | 280.12 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride |
| SMILES | Cl.Cl.Cn1nc(-c2cnccn2)nc1C=O.O |
| InChI | InChI=1S/C8H7N5O.2ClH.H2O/c1-13-7(5-14)11-8(12-13)6-4-9-2-3-10-6;;;/h2-5H,1H3;2*1H;1H2 |
| InChIKey | HMUVXAGJGDAJBG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 105.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.12 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride?
The IUPAC name of 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride (CID 131726170) is 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride.
What is the SMILES notation for 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride?
The canonical SMILES for 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride is Cl.Cl.Cn1nc(-c2cnccn2)nc1C=O.O.
What is the InChIKey of 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride?
The InChIKey is HMUVXAGJGDAJBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O.2ClH.H2O/c1-13-7(5-14)11-8(12-13)6-4-9-2-3-10-6;;;/h2-5H,1H3;2*1H;1H2.
What are the key properties of 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride?
2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride has a molecular weight of 280.12 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-pyrazin-2-yl-1,2,4-triazole-3-carbaldehyde;hydrate;dihydrochloride is sourced from PubChem (CID 131726170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).