About methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate
methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate (PubChem CID 131726218) has the molecular formula C21H18BrF2NO3
and a molecular weight of 450.28 g/mol. Its IUPAC name is methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate.
Molecular Properties
| Compound Name | methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate |
| PubChem CID | 131726218 |
| Molecular Formula | C21H18BrF2NO3 |
| Molecular Weight | 450.28 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/c2ccccc2N(C(=O)c2ccc(Br)cc2C)CCC1(F)F |
| InChI | InChI=1S/C21H18BrF2NO3/c1-13-11-14(22)7-8-15(13)20(27)25-10-9-21(23,24)17(12-19(26)28-2)16-5-3-4-6-18(16)25/h3-8,11-12H,9-10H2,1-2H3/b17-12- |
| InChIKey | WUMBSYFQGUCRLV-ATVHPVEESA-N |
| XLogP | 5.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
The IUPAC name of methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate (CID 131726218) is methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate.
What is the SMILES notation for methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
The canonical SMILES for methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate is COC(=O)/C=C1/c2ccccc2N(C(=O)c2ccc(Br)cc2C)CCC1(F)F.
What is the InChIKey of methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
The InChIKey is WUMBSYFQGUCRLV-ATVHPVEESA-N. The full InChI is InChI=1S/C21H18BrF2NO3/c1-13-11-14(22)7-8-15(13)20(27)25-10-9-21(23,24)17(12-19(26)28-2)16-5-3-4-6-18(16)25/h3-8,11-12H,9-10H2,1-2H3/b17-12-.
What are the key properties of methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate?
methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate has a molecular weight of 450.28 g/mol, XLogP of 5.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-2-[1-(4-bromo-2-methylbenzoyl)-4,4-difluoro-2,3-dihydro-1-benzazepin-5-ylidene]acetate is sourced from PubChem (CID 131726218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).