C35H31F3N4O4 — CID 131726299
ethyl (9aS)-5-oxo-4-[4-(phenylcarbamoylamino)phenyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate (PubChem CID 131726299) has the molecular formula C35H31F3N4O4 and a molecular weight of 628.65 g/mol. Its IUPAC name is ethyl (9aS)-5-oxo-4-[4-(phenylcarbamoylamino)phenyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate.
| Compound Name | ethyl (9aS)-5-oxo-4-[4-(phenylcarbamoylamino)phenyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate |
|---|---|
| PubChem CID | 131726299 |
| Molecular Formula | C35H31F3N4O4 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | ethyl (9aS)-5-oxo-4-[4-(phenylcarbamoylamino)phenyl]-2-[2-[4-(trifluoromethyl)phenyl]ethyl]-7,8,9,9a-tetrahydropyrido[2,3-a]pyrrolizine-3-carboxylate |
| SMILES | CCOC(=O)c1c(CCc2ccc(C(F)(F)F)cc2)nc2c(c1-c1ccc(NC(=O)Nc3ccccc3)cc1)C(=O)N1CCC[C@@H]21 |
| InChI | InChI=1S/C35H31F3N4O4/c1-2-46-33(44)29-26(19-12-21-10-15-23(16-11-21)35(36,37)38)41-31-27-9-6-20-42(27)32(43)30(31)28(29)22-13-17-25(18-14-22)40-34(45)39-24-7-4-3-5-8-24/h3-5,7-8,10-11,13-18,27H,2,6,9,12,19-20H2,1H3,(H2,39,40,45)/t27-/m0/s1 |
| InChIKey | GXGNFVGVCMCKAY-MHZLTWQESA-N |
| XLogP | 7.66 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |