C12H16F9NO4S — CID 131726677
ethyl 2-[butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetate (PubChem CID 131726677) has the molecular formula C12H16F9NO4S and a molecular weight of 441.31 g/mol. Its IUPAC name is ethyl 2-[butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetate.
| Compound Name | ethyl 2-[butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetate |
|---|---|
| PubChem CID | 131726677 |
| Molecular Formula | C12H16F9NO4S |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | ethyl 2-[butyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]acetate |
| SMILES | CCCCN(CC(=O)OCC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F9NO4S/c1-3-5-6-22(7-8(23)26-4-2)27(24,25)12(20,21)10(15,16)9(13,14)11(17,18)19/h3-7H2,1-2H3 |
| InChIKey | YHVRGGIASYAEEK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|