C11H14F9NO4S — CID 131726678
ethyl 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetate (PubChem CID 131726678) has the molecular formula C11H14F9NO4S and a molecular weight of 427.29 g/mol. Its IUPAC name is ethyl 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetate.
| Compound Name | ethyl 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetate |
|---|---|
| PubChem CID | 131726678 |
| Molecular Formula | C11H14F9NO4S |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | ethyl 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetate |
| SMILES | CCCN(CC(=O)OCC)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F9NO4S/c1-3-5-21(6-7(22)25-4-2)26(23,24)11(19,20)9(14,15)8(12,13)10(16,17)18/h3-6H2,1-2H3 |
| InChIKey | COCHFZWLJBHYBB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|