C8H12ClF3N4 — CID 131726716
6,8-dimethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride (PubChem CID 131726716) has the molecular formula C8H12ClF3N4 and a molecular weight of 256.66 g/mol. Its IUPAC name is 6,8-dimethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride.
| Compound Name | 6,8-dimethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
|---|---|
| PubChem CID | 131726716 |
| Molecular Formula | C8H12ClF3N4 |
| Molecular Weight | 256.66 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 6,8-dimethyl-3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
| SMILES | CC1Cn2c(nnc2C(F)(F)F)C(C)N1.Cl |
| InChI | InChI=1S/C8H11F3N4.ClH/c1-4-3-15-6(5(2)12-4)13-14-7(15)8(9,10)11;/h4-5,12H,3H2,1-2H3;1H |
| InChIKey | KTDDZPSPCMGHJD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.66 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |