C16H17F3O4 — CID 131727250
methyl (7R,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decane-7-carboxylate (PubChem CID 131727250) has the molecular formula C16H17F3O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is methyl (7R,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decane-7-carboxylate.
| Compound Name | methyl (7R,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 131727250 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | methyl (7R,8R)-8-(2,4,5-trifluorophenyl)-1,4-dioxaspiro[4.5]decane-7-carboxylate |
| SMILES | COC(=O)[C@@H]1CC2(CC[C@H]1c1cc(F)c(F)cc1F)OCCO2 |
| InChI | InChI=1S/C16H17F3O4/c1-21-15(20)11-8-16(22-4-5-23-16)3-2-9(11)10-6-13(18)14(19)7-12(10)17/h6-7,9,11H,2-5,8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | SGSMXGOBUDMEOQ-GXSJLCMTSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|