C25H40F3NO3Si — CID 131727727
N-[(3R)-4-tert-butylsilyloxy-3,4-dimethyl-1-[4-(6,6,6-trifluorohexanoyl)phenyl]pentan-3-yl]acetamide (PubChem CID 131727727) has the molecular formula C25H40F3NO3Si and a molecular weight of 487.68 g/mol. Its IUPAC name is N-[(3R)-4-tert-butylsilyloxy-3,4-dimethyl-1-[4-(6,6,6-trifluorohexanoyl)phenyl]pentan-3-yl]acetamide.
| Compound Name | N-[(3R)-4-tert-butylsilyloxy-3,4-dimethyl-1-[4-(6,6,6-trifluorohexanoyl)phenyl]pentan-3-yl]acetamide |
|---|---|
| PubChem CID | 131727727 |
| Molecular Formula | C25H40F3NO3Si |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | N-[(3R)-4-tert-butylsilyloxy-3,4-dimethyl-1-[4-(6,6,6-trifluorohexanoyl)phenyl]pentan-3-yl]acetamide |
| SMILES | CC(=O)N[C@](C)(CCc1ccc(C(=O)CCCCC(F)(F)F)cc1)C(C)(C)O[SiH2]C(C)(C)C |
| InChI | InChI=1S/C25H40F3NO3Si/c1-18(30)29-24(7,23(5,6)32-33-22(2,3)4)17-15-19-11-13-20(14-12-19)21(31)10-8-9-16-25(26,27)28/h11-14H,8-10,15-17,33H2,1-7H3,(H,29,30)/t24-/m1/s1 |
| InChIKey | LIZAYXCPDPVCNK-XMMPIXPASA-N |
| XLogP | 5.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|