C19H25F6N3O5 — CID 131727836
1-[4-(4-aminophenyl)piperidin-1-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 131727836) has the molecular formula C19H25F6N3O5 and a molecular weight of 489.41 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)piperidin-1-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[4-(4-aminophenyl)piperidin-1-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 131727836 |
| Molecular Formula | C19H25F6N3O5 |
| Molecular Weight | 489.41 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 1-[4-(4-aminophenyl)piperidin-1-yl]-2-(dimethylamino)ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CC(=O)N1CCC(c2ccc(N)cc2)CC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O.2C2HF3O2/c1-17(2)11-15(19)18-9-7-13(8-10-18)12-3-5-14(16)6-4-12;2*3-2(4,5)1(6)7/h3-6,13H,7-11,16H2,1-2H3;2*(H,6,7) |
| InChIKey | MCZLHAWPRXMLDS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|