About 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid
10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid (PubChem CID 131728433) has the molecular formula C14H11NO5S
and a molecular weight of 305.31 g/mol. Its IUPAC name is 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid.
Molecular Properties
| Compound Name | 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid |
| PubChem CID | 131728433 |
| Molecular Formula | C14H11NO5S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid |
| SMILES | Nc1cccc2c1Oc1ccc(C(=O)O)cc1S(=O)(=O)C2 |
| InChI | InChI=1S/C14H11NO5S/c15-10-3-1-2-9-7-21(18,19)12-6-8(14(16)17)4-5-11(12)20-13(9)10/h1-6H,7,15H2,(H,16,17) |
| InChIKey | HXMYCDADCJZRSL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid?
The IUPAC name of 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid (CID 131728433) is 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid.
What is the SMILES notation for 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid?
The canonical SMILES for 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid is Nc1cccc2c1Oc1ccc(C(=O)O)cc1S(=O)(=O)C2.
What is the InChIKey of 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid?
The InChIKey is HXMYCDADCJZRSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO5S/c15-10-3-1-2-9-7-21(18,19)12-6-8(14(16)17)4-5-11(12)20-13(9)10/h1-6H,7,15H2,(H,16,17).
What are the key properties of 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid?
10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid has a molecular weight of 305.31 g/mol, XLogP of 2.05, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-amino-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxylic acid is sourced from PubChem (CID 131728433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).