C28H27Cl3N2O3 — CID 131728591
4,5-bis(4-chlorophenyl)-5-ethyl-2-(4-methoxy-2-propan-2-yloxyphenyl)-4H-imidazole-3-carbonyl chloride (PubChem CID 131728591) has the molecular formula C28H27Cl3N2O3 and a molecular weight of 545.89 g/mol. Its IUPAC name is 4,5-bis(4-chlorophenyl)-5-ethyl-2-(4-methoxy-2-propan-2-yloxyphenyl)-4H-imidazole-3-carbonyl chloride.
| Compound Name | 4,5-bis(4-chlorophenyl)-5-ethyl-2-(4-methoxy-2-propan-2-yloxyphenyl)-4H-imidazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 131728591 |
| Molecular Formula | C28H27Cl3N2O3 |
| Molecular Weight | 545.89 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 4,5-bis(4-chlorophenyl)-5-ethyl-2-(4-methoxy-2-propan-2-yloxyphenyl)-4H-imidazole-3-carbonyl chloride |
| SMILES | CCC1(c2ccc(Cl)cc2)N=C(c2ccc(OC)cc2OC(C)C)N(C(=O)Cl)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H27Cl3N2O3/c1-5-28(19-8-12-21(30)13-9-19)25(18-6-10-20(29)11-7-18)33(27(31)34)26(32-28)23-15-14-22(35-4)16-24(23)36-17(2)3/h6-17,25H,5H2,1-4H3 |
| InChIKey | LFWPTPCRHFBTOU-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.89 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|