C22H26F3N5O4 — CID 131728649
tert-butyl N-[(3R,4R)-1-[6-(methylamino)-5-nitro-2-pyridinyl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 131728649) has the molecular formula C22H26F3N5O4 and a molecular weight of 481.48 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-[6-(methylamino)-5-nitro-2-pyridinyl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-[6-(methylamino)-5-nitro-2-pyridinyl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 131728649 |
| Molecular Formula | C22H26F3N5O4 |
| Molecular Weight | 481.48 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-[6-(methylamino)-5-nitro-2-pyridinyl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | CNc1nc(N2CC[C@H](c3cc(F)c(F)cc3F)[C@@H](NC(=O)OC(C)(C)C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26F3N5O4/c1-22(2,3)34-21(31)27-17-11-29(19-6-5-18(30(32)33)20(26-4)28-19)8-7-12(17)13-9-15(24)16(25)10-14(13)23/h5-6,9-10,12,17H,7-8,11H2,1-4H3,(H,26,28)(H,27,31)/t12-,17+/m1/s1 |
| InChIKey | KOGXQVNUEDYXQM-PXAZEXFGSA-N |
| XLogP | 4.34 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|