About Tetramethyldisilazane sodium tetrahydrofuran
Tetramethyldisilazane sodium tetrahydrofuran (PubChem CID 131728924) has the molecular formula C8H23NNaOSi2
and a molecular weight of 228.44 g/mol.
Molecular Properties
| Compound Name | Tetramethyldisilazane sodium tetrahydrofuran |
| PubChem CID | 131728924 |
| Molecular Formula | C8H23NNaOSi2 |
| Molecular Weight | 228.44 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | — |
| SMILES | C1CCOC1.CN([SiH3])[Si](C)(C)C.[Na] |
| InChI | InChI=1S/C4H15NSi2.C4H8O.Na/c1-5(6)7(2,3)4;1-2-4-5-3-1;/h1-4,6H3;1-4H2; |
| InChIKey | XXPPGBRCOZXGKP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Tetramethyldisilazane sodium tetrahydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetramethyldisilazane sodium tetrahydrofuran?
The IUPAC name of Tetramethyldisilazane sodium tetrahydrofuran (CID 131728924) is not available.
What is the SMILES notation for Tetramethyldisilazane sodium tetrahydrofuran?
The canonical SMILES for Tetramethyldisilazane sodium tetrahydrofuran is C1CCOC1.CN([SiH3])[Si](C)(C)C.[Na].
What is the InChIKey of Tetramethyldisilazane sodium tetrahydrofuran?
The InChIKey is XXPPGBRCOZXGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H15NSi2.C4H8O.Na/c1-5(6)7(2,3)4;1-2-4-5-3-1;/h1-4,6H3;1-4H2;.
What are the key properties of Tetramethyldisilazane sodium tetrahydrofuran?
Tetramethyldisilazane sodium tetrahydrofuran has a molecular weight of 228.44 g/mol, XLogP of 0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Tetramethyldisilazane sodium tetrahydrofuran is sourced from PubChem (CID 131728924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).