C15H20F3NO7S — CID 131728966
8-O-tert-butyl 2-O-methyl (1R,5S)-3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate (PubChem CID 131728966) has the molecular formula C15H20F3NO7S and a molecular weight of 415.39 g/mol. Its IUPAC name is 8-O-tert-butyl 2-O-methyl (1R,5S)-3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 2-O-methyl (1R,5S)-3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
|---|---|
| PubChem CID | 131728966 |
| Molecular Formula | C15H20F3NO7S |
| Molecular Weight | 415.39 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 8-O-tert-butyl 2-O-methyl (1R,5S)-3-(trifluoromethylsulfonyloxy)-8-azabicyclo[3.2.1]oct-2-ene-2,8-dicarboxylate |
| SMILES | COC(=O)C1=C(OS(=O)(=O)C(F)(F)F)C[C@@H]2CC[C@H]1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20F3NO7S/c1-14(2,3)25-13(21)19-8-5-6-9(19)11(12(20)24-4)10(7-8)26-27(22,23)15(16,17)18/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | WPGMCSHMQFLYGZ-DTWKUNHWSA-N |
| XLogP | 2.45 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|