About 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one
2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one (PubChem CID 131729126) has the molecular formula C15H19F3N2O2S
and a molecular weight of 348.39 g/mol. Its IUPAC name is 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one |
| PubChem CID | 131729126 |
| Molecular Formula | C15H19F3N2O2S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one |
| SMILES | CCCC(CC)C(N)=O.O=c1[nH]c2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C8H4F3NOS.C7H15NO/c9-8(10,11)4-1-2-6-5(3-4)12-7(13)14-6;1-3-5-6(4-2)7(8)9/h1-3H,(H,12,13);6H,3-5H2,1-2H3,(H2,8,9) |
| InChIKey | DCXSDYQJXBCPGD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one?
The IUPAC name of 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one (CID 131729126) is 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one is CCCC(CC)C(N)=O.O=c1[nH]c2cc(C(F)(F)F)ccc2s1.
What is the InChIKey of 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one?
The InChIKey is DCXSDYQJXBCPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3NOS.C7H15NO/c9-8(10,11)4-1-2-6-5(3-4)12-7(13)14-6;1-3-5-6(4-2)7(8)9/h1-3H,(H,12,13);6H,3-5H2,1-2H3,(H2,8,9).
What are the key properties of 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one?
2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one has a molecular weight of 348.39 g/mol, XLogP of 3.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentanamide;5-(trifluoromethyl)-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 131729126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).