C29H27F2O6S2+ — CID 131729200
benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid (PubChem CID 131729200) has the molecular formula C29H27F2O6S2+ and a molecular weight of 573.66 g/mol. Its IUPAC name is benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid.
| Compound Name | benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid |
|---|---|
| PubChem CID | 131729200 |
| Molecular Formula | C29H27F2O6S2+ |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | benzhydryl(phenyl)sulfanium;1,1-difluoro-2-(2-phenoxyacetyl)oxyethanesulfonic acid |
| SMILES | O=C(COc1ccccc1)OCC(F)(F)S(=O)(=O)O.c1ccc([SH+]C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16S.C10H10F2O6S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)20-18-14-8-3-9-15-18;11-10(12,19(14,15)16)7-18-9(13)6-17-8-4-2-1-3-5-8/h1-15,19H;1-5H,6-7H2,(H,14,15,16)/p+1 |
| InChIKey | HEIPADRYPWHJOP-UHFFFAOYSA-O |
| XLogP | 5.74 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|