C39H58N2O6 — CID 131729244
2-hydroxyethyl 2-methylprop-2-enoate;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;3-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenol (PubChem CID 131729244) has the molecular formula C39H58N2O6 and a molecular weight of 650.90 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;3-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenol.
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;3-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenol |
|---|---|
| PubChem CID | 131729244 |
| Molecular Formula | C39H58N2O6 |
| Molecular Weight | 650.90 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;5-isocyanato-1-(isocyanatomethyl)-1,3,3-trimethylcyclohexane;3-[(8Z,11Z)-pentadeca-8,11,14-trienyl]phenol |
| SMILES | C=C(C)C(=O)OCCO.C=CC/C=C\C/C=C\CCCCCCCc1cccc(O)c1.CC1(C)CC(N=C=O)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C21H30O.C12H18N2O2.C6H10O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20;1-11(2)4-10(14-9-16)5-12(3,6-11)7-13-8-15;1-5(2)6(8)9-4-3-7/h2,4-5,7-8,15,17-19,22H,1,3,6,9-14,16H2;10H,4-7H2,1-3H3;7H,1,3-4H2,2H3/b5-4-,8-7-;; |
| InChIKey | YNFNBWKHLLIXSB-CZKXHGEOSA-N |
| XLogP | 8.69 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.90 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|