About 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride
8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride (PubChem CID 131729351) has the molecular formula C19H16Cl2N2
and a molecular weight of 343.26 g/mol. Its IUPAC name is 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride.
Molecular Properties
| Compound Name | 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride |
| PubChem CID | 131729351 |
| Molecular Formula | C19H16Cl2N2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride |
| SMILES | Cc1ccc2[nH]c(C)c(-c3ccnc4c(Cl)cccc34)c2c1.Cl |
| InChI | InChI=1S/C19H15ClN2.ClH/c1-11-6-7-17-15(10-11)18(12(2)22-17)13-8-9-21-19-14(13)4-3-5-16(19)20;/h3-10,22H,1-2H3;1H |
| InChIKey | BRRMBWKTNRCABE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride?
The IUPAC name of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride (CID 131729351) is 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride.
What is the SMILES notation for 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride?
The canonical SMILES for 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride is Cc1ccc2[nH]c(C)c(-c3ccnc4c(Cl)cccc34)c2c1.Cl.
What is the InChIKey of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride?
The InChIKey is BRRMBWKTNRCABE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClN2.ClH/c1-11-6-7-17-15(10-11)18(12(2)22-17)13-8-9-21-19-14(13)4-3-5-16(19)20;/h3-10,22H,1-2H3;1H.
What are the key properties of 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride?
8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride has a molecular weight of 343.26 g/mol, XLogP of 6.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4-(2,5-dimethyl-1H-indol-3-yl)quinoline;hydrochloride is sourced from PubChem (CID 131729351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).