C14H20F2N2O — CID 131729604
7-N-(2,2-difluoroethyl)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-4,7-diamine (PubChem CID 131729604) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 7-N-(2,2-difluoroethyl)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-4,7-diamine.
| Compound Name | 7-N-(2,2-difluoroethyl)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-4,7-diamine |
|---|---|
| PubChem CID | 131729604 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 7-N-(2,2-difluoroethyl)-3-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-4,7-diamine |
| SMILES | COc1ccc2c(c1N)CCC(NCC(F)F)CC2 |
| InChI | InChI=1S/C14H20F2N2O/c1-19-12-7-3-9-2-4-10(18-8-13(15)16)5-6-11(9)14(12)17/h3,7,10,13,18H,2,4-6,8,17H2,1H3 |
| InChIKey | ILUCNXOGQGFFFY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|