About (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one
(5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one (PubChem CID 131729663) has the molecular formula C13H22O8
and a molecular weight of 306.31 g/mol. Its IUPAC name is (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one.
Molecular Properties
| Compound Name | (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one |
| PubChem CID | 131729663 |
| Molecular Formula | C13H22O8 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one |
| SMILES | CCCCOC1=C(O)C(=O)O[C@]1(CC(O)CO)[C@@H](O)CO |
| InChI | InChI=1S/C13H22O8/c1-2-3-4-20-11-10(18)12(19)21-13(11,9(17)7-15)5-8(16)6-14/h8-9,14-18H,2-7H2,1H3/t8?,9-,13+/m0/s1 |
| InChIKey | JLKUBJRYNNFKEV-AAHVFUIXSA-N |
| XLogP | -1.04 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one?
The IUPAC name of (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one (CID 131729663) is (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one.
What is the SMILES notation for (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one?
The canonical SMILES for (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one is CCCCOC1=C(O)C(=O)O[C@]1(CC(O)CO)[C@@H](O)CO.
What is the InChIKey of (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one?
The InChIKey is JLKUBJRYNNFKEV-AAHVFUIXSA-N. The full InChI is InChI=1S/C13H22O8/c1-2-3-4-20-11-10(18)12(19)21-13(11,9(17)7-15)5-8(16)6-14/h8-9,14-18H,2-7H2,1H3/t8?,9-,13+/m0/s1.
What are the key properties of (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one?
(5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one has a molecular weight of 306.31 g/mol, XLogP of -1.04, 9 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-4-butoxy-5-[(1S)-1,2-dihydroxyethyl]-5-(2,3-dihydroxypropyl)-3-hydroxyfuran-2-one is sourced from PubChem (CID 131729663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).