C13H19F2NO5 — CID 131730446
methyl (2R,4S)-2-(difluoromethyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate (PubChem CID 131730446) has the molecular formula C13H19F2NO5 and a molecular weight of 307.29 g/mol. Its IUPAC name is methyl (2R,4S)-2-(difluoromethyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate.
| Compound Name | methyl (2R,4S)-2-(difluoromethyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131730446 |
| Molecular Formula | C13H19F2NO5 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl (2R,4S)-2-(difluoromethyl)-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)CC(=O)[C@H]1CCN(C(=O)OC)[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C13H19F2NO5/c1-3-21-11(18)7-10(17)8-4-5-16(13(19)20-2)9(6-8)12(14)15/h8-9,12H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | XRMCAEWPEZUNQU-DTWKUNHWSA-N |
| XLogP | 1.62 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|