About (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid
(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid (PubChem CID 131731050) has the molecular formula C16H23N5O8
and a molecular weight of 413.39 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid.
Molecular Properties
| Compound Name | (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid |
| PubChem CID | 131731050 |
| Molecular Formula | C16H23N5O8 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid |
| SMILES | NCCCC[C@H](NC(=O)CN)C(=O)O.O=C(O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H17N3O3.C8H6N2O5/c9-4-2-1-3-6(8(13)14)11-7(12)5-10;11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h6H,1-5,9-10H2,(H,11,12)(H,13,14);1-4H,(H,9,11)(H,12,13)/t6-;/m0./s1 |
| InChIKey | RZHAVDPXTQIEOV-RGMNGODLSA-N |
| XLogP | -0.74 |
| TPSA | 227.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid?
The IUPAC name of (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid (CID 131731050) is (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid.
What is the SMILES notation for (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid?
The canonical SMILES for (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid is NCCCC[C@H](NC(=O)CN)C(=O)O.O=C(O)C(=O)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid?
The InChIKey is RZHAVDPXTQIEOV-RGMNGODLSA-N. The full InChI is InChI=1S/C8H17N3O3.C8H6N2O5/c9-4-2-1-3-6(8(13)14)11-7(12)5-10;11-7(8(12)13)9-5-1-3-6(4-2-5)10(14)15/h6H,1-5,9-10H2,(H,11,12)(H,13,14);1-4H,(H,9,11)(H,12,13)/t6-;/m0./s1.
What are the key properties of (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid?
(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid has a molecular weight of 413.39 g/mol, XLogP of -0.74, 9 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid;2-(4-nitroanilino)-2-oxoacetic acid is sourced from PubChem (CID 131731050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).