C40H78N4 — CID 131731190
2,2,6,6-tetramethyl-4-[2,3,3-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine (PubChem CID 131731190) has the molecular formula C40H78N4 and a molecular weight of 615.09 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[2,3,3-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[2,3,3-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine |
|---|---|
| PubChem CID | 131731190 |
| Molecular Formula | C40H78N4 |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.62 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[2,3,3-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine |
| SMILES | CC1(C)CC(C(C)(C2CC(C)(C)NC(C)(C)C2)C(C)(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C40H78N4/c1-31(2)19-27(20-32(3,4)41-31)39(17,28-21-33(5,6)42-34(7,8)22-28)40(18,29-23-35(9,10)43-36(11,12)24-29)30-25-37(13,14)44-38(15,16)26-30/h27-30,41-44H,19-26H2,1-18H3 |
| InChIKey | NNHCUUDLVIXLLQ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |