About lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole
lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole (PubChem CID 131731360) has the molecular formula C5H4F6LiN3O4S2
and a molecular weight of 355.17 g/mol. Its IUPAC name is lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole.
Molecular Properties
| Compound Name | lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole |
| PubChem CID | 131731360 |
| Molecular Formula | C5H4F6LiN3O4S2 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li+].c1cn[nH]c1 |
| InChI | InChI=1S/C3H4N2.C2F6NO4S2.Li/c1-2-4-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h1-3H,(H,4,5);;/q;-1;+1 |
| InChIKey | WGFPRAGBZOVOSA-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole?
The IUPAC name of lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole (CID 131731360) is lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole.
What is the SMILES notation for lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole?
The canonical SMILES for lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole is O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li+].c1cn[nH]c1.
What is the InChIKey of lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole?
The InChIKey is WGFPRAGBZOVOSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.C2F6NO4S2.Li/c1-2-4-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h1-3H,(H,4,5);;/q;-1;+1.
What are the key properties of lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole?
lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole has a molecular weight of 355.17 g/mol, XLogP of -1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;bis(trifluoromethylsulfonyl)azanide;1H-pyrazole is sourced from PubChem (CID 131731360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).