About lithium;acetamide;bis(trifluoromethylsulfonyl)azanide
lithium;acetamide;bis(trifluoromethylsulfonyl)azanide (PubChem CID 131731365) has the molecular formula C4H5F6LiN2O5S2
and a molecular weight of 346.16 g/mol. Its IUPAC name is lithium;acetamide;bis(trifluoromethylsulfonyl)azanide.
Molecular Properties
| Compound Name | lithium;acetamide;bis(trifluoromethylsulfonyl)azanide |
| PubChem CID | 131731365 |
| Molecular Formula | C4H5F6LiN2O5S2 |
| Molecular Weight | 346.16 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | lithium;acetamide;bis(trifluoromethylsulfonyl)azanide |
| SMILES | CC(N)=O.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li+] |
| InChI | InChI=1S/C2F6NO4S2.C2H5NO.Li/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;1-2(3)4;/h;1H3,(H2,3,4);/q-1;;+1 |
| InChIKey | PXMNOZKHCOOVFK-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.16 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium;acetamide;bis(trifluoromethylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;acetamide;bis(trifluoromethylsulfonyl)azanide?
The IUPAC name of lithium;acetamide;bis(trifluoromethylsulfonyl)azanide (CID 131731365) is lithium;acetamide;bis(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for lithium;acetamide;bis(trifluoromethylsulfonyl)azanide?
The canonical SMILES for lithium;acetamide;bis(trifluoromethylsulfonyl)azanide is CC(N)=O.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Li+].
What is the InChIKey of lithium;acetamide;bis(trifluoromethylsulfonyl)azanide?
The InChIKey is PXMNOZKHCOOVFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2F6NO4S2.C2H5NO.Li/c3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;1-2(3)4;/h;1H3,(H2,3,4);/q-1;;+1.
What are the key properties of lithium;acetamide;bis(trifluoromethylsulfonyl)azanide?
lithium;acetamide;bis(trifluoromethylsulfonyl)azanide has a molecular weight of 346.16 g/mol, XLogP of -2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;acetamide;bis(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 131731365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).